CAS 34469-09-5 is the registry number for (R)-2-(Dimethylamino)-1-phenylethanol. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1R)-2-(dimethylamino)-1-phenylethanol (CAS 34469-09-5) is a chemical compound with the molecular formula C10H15NO and a molecular weight of 165.23 g/mol. IUPAC name: (1R)-2-(dimethylamino)-1-phenylethanol. InChIKey: FUKFNSSCQOYPRM-JTQLQIEISA-N.
| Molecular formula | C10H15NO |
|---|---|
| Molecular weight | 165.23 g/mol |
| IUPAC name | (1R)-2-(dimethylamino)-1-phenylethanol |
| InChIKey | FUKFNSSCQOYPRM-JTQLQIEISA-N |
| SMILES | CN(C)C[C@@H](C1=CC=CC=C1)O |
Computed by PubChem (NCBI)