Products 344775-04-8

CAS 344775-04-8 is the registry number for (S)-5-Cyclohexyl-2-methylpenta-3,4-dien-2-ol, 98%. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-cyclohexyl-2-methylpenta-3,4-dien-2-ol (CAS 344775-04-8) is a chemical compound with the molecular formula C12H20O and a molecular weight of 180.29 g/mol. IUPAC name: 5-cyclohexyl-2-methylpenta-3,4-dien-2-ol. InChIKey: CFJUQUCVSAYSKP-UHFFFAOYSA-N.

Identity
Molecular formulaC12H20O
Molecular weight180.29 g/mol
IUPAC name5-cyclohexyl-2-methylpenta-3,4-dien-2-ol
InChIKeyCFJUQUCVSAYSKP-UHFFFAOYSA-N
SMILESCC(C)(C=C=CC1CCCCC1)O

Computed by PubChem (NCBI)