CAS 26750-08-3 appears in our catalog under these names: 1-(1-Adamantyl)ethanol, 95%, 1-(1-Adamantyl)ethanol, 1-(Adamantan-1-yl)ethanol, 95+%. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 1g, 5g, 10g.
1-(1-adamantyl)ethanol (CAS 26750-08-3) is a chemical compound with the molecular formula C12H20O and a molecular weight of 180.29 g/mol. IUPAC name: 1-(1-adamantyl)ethanol. InChIKey: YALBLVPSPRKDJI-UHFFFAOYSA-N.
| Molecular formula | C12H20O |
|---|---|
| Molecular weight | 180.29 g/mol |
| IUPAC name | 1-(1-adamantyl)ethanol |
| InChIKey | YALBLVPSPRKDJI-UHFFFAOYSA-N |
| SMILES | CC(C12CC3CC(C1)CC(C3)C2)O |
Computed by PubChem (NCBI)