CAS 344776-74-5 appears in our catalog under these names: 2-Chloro-6-(2,2,2-trifluoro-1-hydroxyethyl)pyridin-3-ol, 95%, 2–Chloro–6–(2,2,2–trifluoro–1–hydroxyethyl)pyridin–3–ol. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-chloro-6-(2,2,2-trifluoro-1-hydroxyethyl)pyridin-3-ol (CAS 344776-74-5) is a chemical compound with the molecular formula C7H5ClF3NO2 and a molecular weight of 227.57 g/mol. IUPAC name: 2-chloro-6-(2,2,2-trifluoro-1-hydroxyethyl)pyridin-3-ol. InChIKey: CKPRMYICFAOSPJ-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF3NO2 |
|---|---|
| Molecular weight | 227.57 g/mol |
| IUPAC name | 2-chloro-6-(2,2,2-trifluoro-1-hydroxyethyl)pyridin-3-ol |
| InChIKey | CKPRMYICFAOSPJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1O)Cl)C(C(F)(F)F)O |
Computed by PubChem (NCBI)