Products 34482-99-0
CAS 34482-99-0 is the registry number for Fletazepam. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-chloro-5-(2-fluorophenyl)-1-(2,2,2-trifluoroethyl)-2,3-dihydro-1,4-benzodiazepine (CAS 34482-99-0) is a chemical compound with the molecular formula C17H13ClF4N2 and a molecular weight of 356.7 g/mol. IUPAC name: 7-chloro-5-(2-fluorophenyl)-1-(2,2,2-trifluoroethyl)-2,3-dihydro-1,4-benzodiazepine. InChIKey: CIZCSUNUBQXVFP-UHFFFAOYSA-N.
| Molecular formula | C17H13ClF4N2 |
|---|---|
| Molecular weight | 356.7 g/mol |
| IUPAC name | 7-chloro-5-(2-fluorophenyl)-1-(2,2,2-trifluoroethyl)-2,3-dihydro-1,4-benzodiazepine |
| InChIKey | CIZCSUNUBQXVFP-UHFFFAOYSA-N |
| SMILES | C1CN(C2=C(C=C(C=C2)Cl)C(=N1)C3=CC=CC=C3F)CC(F)(F)F |
Computed by PubChem (NCBI)