CAS 344940-63-2 appears in our catalog under these names: Diphenylterazine, 95%, Diphenylterazine/ 99.89% (existing batch purity), Diphenylterazine, Diphenylterazine 99%, Diphenylterazine, 99%, 99%. Offered by: Combi-blocks, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 1mg, 5mg, 10mg, 25mg, 50mg.
2-benzyl-6,8-diphenylimidazo[1,2-a]pyrazin-3-ol (CAS 344940-63-2) is a chemical compound with the molecular formula C25H19N3O and a molecular weight of 377.4 g/mol. IUPAC name: 2-benzyl-6,8-diphenylimidazo[1,2-a]pyrazin-3-ol. InChIKey: ZMJMWAVOTYOMRN-UHFFFAOYSA-N.
| Molecular formula | C25H19N3O |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | 2-benzyl-6,8-diphenylimidazo[1,2-a]pyrazin-3-ol |
| InChIKey | ZMJMWAVOTYOMRN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=C(N3C=C(N=C(C3=N2)C4=CC=CC=C4)C5=CC=CC=C5)O |
Computed by PubChem (NCBI)