CAS 345306-41-4 is the registry number for 2,5-Dimethyl-3-phenyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2,5-dimethyl-3-phenyl-5,6-dihydrocyclopenta[b]thiophen-4-one (CAS 345306-41-4) is a chemical compound with the molecular formula C15H14OS and a molecular weight of 242.3 g/mol. IUPAC name: 2,5-dimethyl-3-phenyl-5,6-dihydrocyclopenta[b]thiophen-4-one. InChIKey: GAMREVPIMLZPPU-UHFFFAOYSA-N.
| Molecular formula | C15H14OS |
|---|---|
| Molecular weight | 242.3 g/mol |
| IUPAC name | 2,5-dimethyl-3-phenyl-5,6-dihydrocyclopenta[b]thiophen-4-one |
| InChIKey | GAMREVPIMLZPPU-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(C1=O)C(=C(S2)C)C3=CC=CC=C3 |
Computed by PubChem (NCBI)