CAS 34570-62-2 is the registry number for 9-Hydroxybenz(a)anthracene. Offered by: TRC. Available pack sizes: 100mg.
Benzo[a]anthracen-9-ol (CAS 34570-62-2) is a chemical compound with the molecular formula C18H12O and a molecular weight of 244.3 g/mol. IUPAC name: benzo[a]anthracen-9-ol. InChIKey: RSPOTBWXQUBAQH-UHFFFAOYSA-N.
| Molecular formula | C18H12O |
|---|---|
| Molecular weight | 244.3 g/mol |
| IUPAC name | benzo[a]anthracen-9-ol |
| InChIKey | RSPOTBWXQUBAQH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=CC4=C(C=CC(=C4)O)C=C32 |
Computed by PubChem (NCBI)