Products 34576-80-2

CAS 34576-80-2 is the registry number for 3,7-Dichloro-6-methoxy-1-benzothiophene-2-carbonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

3,7-dichloro-6-methoxy-1-benzothiophene-2-carbonyl chloride (CAS 34576-80-2) is a chemical compound with the molecular formula C10H5Cl3O2S and a molecular weight of 295.6 g/mol. IUPAC name: 3,7-dichloro-6-methoxy-1-benzothiophene-2-carbonyl chloride. InChIKey: RYIXVDARTFRZDX-UHFFFAOYSA-N.

Identity
Molecular formulaC10H5Cl3O2S
Molecular weight295.6 g/mol
IUPAC name3,7-dichloro-6-methoxy-1-benzothiophene-2-carbonyl chloride
InChIKeyRYIXVDARTFRZDX-UHFFFAOYSA-N
SMILESCOC1=C(C2=C(C=C1)C(=C(S2)C(=O)Cl)Cl)Cl

Computed by PubChem (NCBI)