CAS 34576-90-4 appears in our catalog under these names: 3,4,6-Trichloro-benzo[b]thiophene-2-carboxylic acid, 95%, 3,4,6-Trichloro-1-benzothiophene-2-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 10g.
3,4,6-trichloro-1-benzothiophene-2-carboxylic acid (CAS 34576-90-4) is a chemical compound with the molecular formula C9H3Cl3O2S and a molecular weight of 281.5 g/mol. IUPAC name: 3,4,6-trichloro-1-benzothiophene-2-carboxylic acid. InChIKey: WUTBSOJTMUNLCC-UHFFFAOYSA-N.
| Molecular formula | C9H3Cl3O2S |
|---|---|
| Molecular weight | 281.5 g/mol |
| IUPAC name | 3,4,6-trichloro-1-benzothiophene-2-carboxylic acid |
| InChIKey | WUTBSOJTMUNLCC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1SC(=C2Cl)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)