CAS 34576-92-6 appears in our catalog under these names: 3-Chloro-6-fluoro-1-benzothiophene-2-carboxylic acid, 96%, 3–Chloro–6–fluorobenzo(b)thiophene–2–carboxylic acid, 3-Chloro-6-fluorobenzo[b]thiophene-2-carboxylic acid, 95%, 95%, 3-Chloro-6-fluoro-benzo[b]thiophene-2-carboxylic acid, 95%, 3-Chloro-6-fluorobenzo[b]thiophene-2-carboxylic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 25g, 10g, 1g, 100mg, 250mg.
3-chloro-6-fluoro-1-benzothiophene-2-carboxylic acid (CAS 34576-92-6) is a chemical compound with the molecular formula C9H4ClFO2S and a molecular weight of 230.64 g/mol. IUPAC name: 3-chloro-6-fluoro-1-benzothiophene-2-carboxylic acid. InChIKey: HSRSWUJIPYUCSE-UHFFFAOYSA-N.
| Molecular formula | C9H4ClFO2S |
|---|---|
| Molecular weight | 230.64 g/mol |
| IUPAC name | 3-chloro-6-fluoro-1-benzothiophene-2-carboxylic acid |
| InChIKey | HSRSWUJIPYUCSE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)SC(=C2Cl)C(=O)O |
Computed by PubChem (NCBI)