CAS 3458-81-9 is the registry number for Rel-(1R,3s,5S)-3-chloro-8-azabicyclo[3.2.1]octane hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,5S)-3-chloro-8-azabicyclo[3.2.1]octane;hydrochloride (CAS 3458-81-9) is a chemical compound with the molecular formula C7H13Cl2N and a molecular weight of 182.09 g/mol. IUPAC name: (1R,5S)-3-chloro-8-azabicyclo[3.2.1]octane;hydrochloride. InChIKey: RKOHZAINZXMIOU-FXFNDYDPSA-N.
| Molecular formula | C7H13Cl2N |
|---|---|
| Molecular weight | 182.09 g/mol |
| IUPAC name | (1R,5S)-3-chloro-8-azabicyclo[3.2.1]octane;hydrochloride |
| InChIKey | RKOHZAINZXMIOU-FXFNDYDPSA-N |
| SMILES | C1C[C@H]2CC(C[C@@H]1N2)Cl.Cl |
Computed by PubChem (NCBI)