CAS 34580-13-7 appears in our catalog under these names: Ketotifen, Ketotifen, >95% (HPLC), Ketotifen (Standard), Ketotifen, 99.74%, 2-(1-methylpiperidin-4-ylidene)-6-thiatricyclo[8.4.0.0³,â·]tetradeca-1(14),3(7),4,8,10,12-hexaen-8-ol, 98%. Offered by: Mikromol, LoGiCal, TRC, GLPBio, MedChemExpress. Available pack sizes: 100mg, 10mg, 25mg, 10mM (in 1ml dmso), 50mg, Get quote, 10mM/1mL, 100 mg.
2-(1-methylpiperidin-4-ylidene)-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-8-one (CAS 34580-13-7) is a chemical compound with the molecular formula C19H19NOS and a molecular weight of 309.4 g/mol. IUPAC name: 2-(1-methylpiperidin-4-ylidene)-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-8-one. InChIKey: ZCVMWBYGMWKGHF-UHFFFAOYSA-N.
| Molecular formula | C19H19NOS |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | 2-(1-methylpiperidin-4-ylidene)-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-8-one |
| InChIKey | ZCVMWBYGMWKGHF-UHFFFAOYSA-N |
| SMILES | CN1CCC(=C2C3=C(C(=O)CC4=CC=CC=C42)SC=C3)CC1 |
Computed by PubChem (NCBI)