CAS 345892-71-9 appears in our catalog under these names: SB-611812, 97%, SB 611812/ 99.34% (existing batch purity), SB 611812, SB 611812, 2,6-Dichloro-N-(4-chloro-3-(2-(dimethylamino)ethoxy)phenyl)-4-(trifluoromethyl)benzenesulfonamide, 99.53% ,, 99.53% ,. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 25 mg, 10mM/1mL.
2,6-dichloro-N-[4-chloro-3-[2-(dimethylamino)ethoxy]phenyl]-4-(trifluoromethyl)benzenesulfonamide (CAS 345892-71-9) is a chemical compound with the molecular formula C17H16Cl3F3N2O3S and a molecular weight of 491.7 g/mol. IUPAC name: 2,6-dichloro-N-[4-chloro-3-[2-(dimethylamino)ethoxy]phenyl]-4-(trifluoromethyl)benzenesulfonamide. InChIKey: UIZHOFJFIOCYLH-UHFFFAOYSA-N.
| Molecular formula | C17H16Cl3F3N2O3S |
|---|---|
| Molecular weight | 491.7 g/mol |
| IUPAC name | 2,6-dichloro-N-[4-chloro-3-[2-(dimethylamino)ethoxy]phenyl]-4-(trifluoromethyl)benzenesulfonamide |
| InChIKey | UIZHOFJFIOCYLH-UHFFFAOYSA-N |
| SMILES | CN(C)CCOC1=C(C=CC(=C1)NS(=O)(=O)C2=C(C=C(C=C2Cl)C(F)(F)F)Cl)Cl |
Computed by PubChem (NCBI)