Products 345909-08-2
CAS 345909-08-2 appears in our catalog under these names: (±)-3-Methyloctane-d20, 98 atom % D, min 98% Chemical Purity, 3-Methyloctane-d20. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 5 mg, 10 mg.
1,1,1,2,2,3,3,4,4,5,5,6,7,7,8,8,8-heptadecadeuterio-6-(trideuteriomethyl)octane (CAS 345909-08-2) is a chemical compound with the molecular formula C9H20 and a molecular weight of 148.38 g/mol. IUPAC name: 1,1,1,2,2,3,3,4,4,5,5,6,7,7,8,8,8-heptadecadeuterio-6-(trideuteriomethyl)octane. InChIKey: SEEOMASXHIJCDV-LZJZAJHISA-N.
| Molecular formula | C9H20 |
|---|---|
| Molecular weight | 148.38 g/mol |
| IUPAC name | 1,1,1,2,2,3,3,4,4,5,5,6,7,7,8,8,8-heptadecadeuterio-6-(trideuteriomethyl)octane |
| InChIKey | SEEOMASXHIJCDV-LZJZAJHISA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)