CAS 345909-99-1 appears in our catalog under these names: Methyl Nicotinate-2,4,5,6-d4, Methyl Nicotinate-2,4,5,6-d4, 98 atom % D, min 98% Chemical Purity, Methyl nicotinate–d4, Methyl nicotinate-d4, 99.5%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 100mg, 250mg, 50mg, 1g, 0,5g, 10mg, 25mg, 5mg.
Methyl 2,4,5,6-tetradeuteriopyridine-3-carboxylate (CAS 345909-99-1) is a chemical compound with the molecular formula C7H7NO2 and a molecular weight of 141.16 g/mol. IUPAC name: methyl 2,4,5,6-tetradeuteriopyridine-3-carboxylate. InChIKey: YNBADRVTZLEFNH-QFFDRWTDSA-N.
| Molecular formula | C7H7NO2 |
|---|---|
| Molecular weight | 141.16 g/mol |
| IUPAC name | methyl 2,4,5,6-tetradeuteriopyridine-3-carboxylate |
| InChIKey | YNBADRVTZLEFNH-QFFDRWTDSA-N |
| SMILES | [2H]C1=C(C(=C(N=C1[2H])[2H])C(=O)OC)[2H] |
Computed by PubChem (NCBI)