CAS 345915-64-2 is the registry number for (4-Iodophenyl)methanesulfonyl chloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
(4-iodophenyl)methanesulfonyl chloride (CAS 345915-64-2) is a chemical compound with the molecular formula C7H6ClIO2S and a molecular weight of 316.54 g/mol. IUPAC name: (4-iodophenyl)methanesulfonyl chloride. InChIKey: PKRGFJNLALDQAR-UHFFFAOYSA-N.
| Molecular formula | C7H6ClIO2S |
|---|---|
| Molecular weight | 316.54 g/mol |
| IUPAC name | (4-iodophenyl)methanesulfonyl chloride |
| InChIKey | PKRGFJNLALDQAR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CS(=O)(=O)Cl)I |
Computed by PubChem (NCBI)