CAS 345986-38-1 appears in our catalog under these names: JNK-IN-13, 98%, JNK-IN-13/ 98.74% (existing batch purity), JNK–IN–13, JNK-IN-13, JNK-IN-13, 97.60%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 10mg, 25mg, 50mg, 100mg, 5mg, 50 mg.
2-(1,3-benzothiazol-2-yl)-2-(2-chloropyrimidin-4-yl)acetonitrile (CAS 345986-38-1) is a chemical compound with the molecular formula C13H7ClN4S and a molecular weight of 286.74 g/mol. IUPAC name: 2-(1,3-benzothiazol-2-yl)-2-(2-chloropyrimidin-4-yl)acetonitrile. InChIKey: QVMKLKBODZHJDK-UHFFFAOYSA-N.
| Molecular formula | C13H7ClN4S |
|---|---|
| Molecular weight | 286.74 g/mol |
| IUPAC name | 2-(1,3-benzothiazol-2-yl)-2-(2-chloropyrimidin-4-yl)acetonitrile |
| InChIKey | QVMKLKBODZHJDK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)C(C#N)C3=NC(=NC=C3)Cl |
Computed by PubChem (NCBI)