Products 34635-41-1
CAS 34635-41-1 is the registry number for Abiraterone Impurity 49. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,10R,13S)-3-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,16-decahydrocyclopenta[a]phenanthren-17-one (CAS 34635-41-1) is a chemical compound with the molecular formula C19H26O2 and a molecular weight of 286.4 g/mol. IUPAC name: (3S,10R,13S)-3-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,16-decahydrocyclopenta[a]phenanthren-17-one. InChIKey: JAESBNKKCUYQHC-XLLZLZEESA-N.
| Molecular formula | C19H26O2 |
|---|---|
| Molecular weight | 286.4 g/mol |
| IUPAC name | (3S,10R,13S)-3-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,16-decahydrocyclopenta[a]phenanthren-17-one |
| InChIKey | JAESBNKKCUYQHC-XLLZLZEESA-N |
| SMILES | C[C@]12CC[C@@H](CC1=CCC3C2CC[C@]4(C3=CCC4=O)C)O |
Computed by PubChem (NCBI)