CAS 1818-12-8 is the registry number for 2-Methyl Estradiol. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 50mg, Get quote.
(8R,9S,13S,14S,17S)-2,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (CAS 1818-12-8) is a chemical compound with the molecular formula C19H26O2 and a molecular weight of 286.4 g/mol. IUPAC name: (8R,9S,13S,14S,17S)-2,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol. InChIKey: PAZNMSHBVDFVSA-NNYOOSKESA-N.
| Molecular formula | C19H26O2 |
|---|---|
| Molecular weight | 286.4 g/mol |
| IUPAC name | (8R,9S,13S,14S,17S)-2,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| InChIKey | PAZNMSHBVDFVSA-NNYOOSKESA-N |
| SMILES | CC1=CC2=C(CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CC[C@@H]4O)C)C=C1O |
Computed by PubChem (NCBI)