CAS 346448-88-2 appears in our catalog under these names: 1-[4-(1,1-Dioxido-1,2-benzisothiazol-3-yl)piperazin-1-yl]propan-2-ol, 95%, 3-(4-(2-Hydroxypropyl)piperazin-1-yl)benzo(d)isothiazole 1,1-dioxide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]propan-2-ol (CAS 346448-88-2) is a chemical compound with the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. IUPAC name: 1-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]propan-2-ol. InChIKey: IWZVKZFFBXLUEA-UHFFFAOYSA-N.
| Molecular formula | C14H19N3O3S |
|---|---|
| Molecular weight | 309.39 g/mol |
| IUPAC name | 1-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]propan-2-ol |
| InChIKey | IWZVKZFFBXLUEA-UHFFFAOYSA-N |
| SMILES | CC(CN1CCN(CC1)C2=NS(=O)(=O)C3=CC=CC=C32)O |
Computed by PubChem (NCBI)