CAS 346459-51-6 is the registry number for 3-Bromo-4-[(3-fluorobenzyl)oxy]-5-methoxybenzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-bromo-4-[(3-fluorophenyl)methoxy]-5-methoxybenzaldehyde (CAS 346459-51-6) is a chemical compound with the molecular formula C15H12BrFO3 and a molecular weight of 339.16 g/mol. IUPAC name: 3-bromo-4-[(3-fluorophenyl)methoxy]-5-methoxybenzaldehyde. InChIKey: CVAFHPYMNFZJAR-UHFFFAOYSA-N.
| Molecular formula | C15H12BrFO3 |
|---|---|
| Molecular weight | 339.16 g/mol |
| IUPAC name | 3-bromo-4-[(3-fluorophenyl)methoxy]-5-methoxybenzaldehyde |
| InChIKey | CVAFHPYMNFZJAR-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)C=O)Br)OCC2=CC(=CC=C2)F |
Computed by PubChem (NCBI)