Products 346460-45-5
CAS 346460-45-5 is the registry number for MI-4F. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[(E)-2-(4-fluorophenyl)ethenyl]-N,4-diphenyl-1,3,4-thiadiazol-4-ium-2-amine chloride (CAS 346460-45-5) is a chemical compound with the molecular formula C22H17ClFN3S and a molecular weight of 409.9 g/mol. IUPAC name: 5-[(E)-2-(4-fluorophenyl)ethenyl]-N,4-diphenyl-1,3,4-thiadiazol-4-ium-2-amine chloride. InChIKey: GLQRUQJJAJQPQX-ZUQRMPMESA-M.
| Molecular formula | C22H17ClFN3S |
|---|---|
| Molecular weight | 409.9 g/mol |
| IUPAC name | 5-[(E)-2-(4-fluorophenyl)ethenyl]-N,4-diphenyl-1,3,4-thiadiazol-4-ium-2-amine chloride |
| InChIKey | GLQRUQJJAJQPQX-ZUQRMPMESA-M |
| SMILES | C1=CC=C(C=C1)NC2=N[N+](=C(S2)/C=C/C3=CC=C(C=C3)F)C4=CC=CC=C4.[Cl-] |
Computed by PubChem (NCBI)