CAS 34648-99-2 appears in our catalog under these names: 4-Chloro-2-methyl-5-nitroaniline, 4-Chloro-2-methyl-5-nitroaniline 95%. Offered by: Biosynth, Ambeed. Available pack sizes: 2,5g, 250mg, 100mg, 1g, 5g.
4-chloro-2-methyl-5-nitroaniline (CAS 34648-99-2) is a chemical compound with the molecular formula C7H7ClN2O2 and a molecular weight of 186.59 g/mol. IUPAC name: 4-chloro-2-methyl-5-nitroaniline. InChIKey: WUSAYXHDBDAHGU-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O2 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | 4-chloro-2-methyl-5-nitroaniline |
| InChIKey | WUSAYXHDBDAHGU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1N)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)