CAS 346640-72-0 appears in our catalog under these names: N-(3-Aminophenyl)-2-chloro-4,5-difluorobenzamide, 95%, N-(3-Aminophenyl)-2-chloro-4,5-difluorobenzamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
N-(3-aminophenyl)-2-chloro-4,5-difluorobenzamide (CAS 346640-72-0) is a chemical compound with the molecular formula C13H9ClF2N2O and a molecular weight of 282.67 g/mol. IUPAC name: N-(3-aminophenyl)-2-chloro-4,5-difluorobenzamide. InChIKey: MDBKVHKXISWPFW-UHFFFAOYSA-N.
| Molecular formula | C13H9ClF2N2O |
|---|---|
| Molecular weight | 282.67 g/mol |
| IUPAC name | N-(3-aminophenyl)-2-chloro-4,5-difluorobenzamide |
| InChIKey | MDBKVHKXISWPFW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC(=O)C2=CC(=C(C=C2Cl)F)F)N |
Computed by PubChem (NCBI)