CAS 346660-34-2 is the registry number for Hakin-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[5-[2-(4-nitrophenyl)-2-oxoethyl]sulfanyltetrazol-1-yl]benzoic acid (CAS 346660-34-2) is a chemical compound with the molecular formula C16H11N5O5S and a molecular weight of 385.4 g/mol. IUPAC name: 4-[5-[2-(4-nitrophenyl)-2-oxoethyl]sulfanyltetrazol-1-yl]benzoic acid. InChIKey: NYIQVTKVZCHUAM-UHFFFAOYSA-N.
| Molecular formula | C16H11N5O5S |
|---|---|
| Molecular weight | 385.4 g/mol |
| IUPAC name | 4-[5-[2-(4-nitrophenyl)-2-oxoethyl]sulfanyltetrazol-1-yl]benzoic acid |
| InChIKey | NYIQVTKVZCHUAM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)N2C(=NN=N2)SCC(=O)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)