CAS 346669-54-3 is the registry number for (R)-Propane-1,2-diamine bis((2R,3R)-2,3-dihydroxysuccinate), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Bis((2R,3R)-2,3-dihydroxybutanedioic acid);(2R)-propane-1,2-diamine (CAS 346669-54-3) is a chemical compound with the molecular formula C11H22N2O12 and a molecular weight of 374.30 g/mol. IUPAC name: bis((2R,3R)-2,3-dihydroxybutanedioic acid);(2R)-propane-1,2-diamine. InChIKey: KYFFPKYLGZVWOL-FCZWFFATSA-N.
| Molecular formula | C11H22N2O12 |
|---|---|
| Molecular weight | 374.30 g/mol |
| IUPAC name | bis((2R,3R)-2,3-dihydroxybutanedioic acid);(2R)-propane-1,2-diamine |
| InChIKey | KYFFPKYLGZVWOL-FCZWFFATSA-N |
| SMILES | C[C@H](CN)N.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)