Products 346688-39-9
CAS 346688-39-9 is the registry number for 4-(3-(Methylsulfonyl)phenyl)-1-propyl-1,2,3,6-tetrahydropyridine. Offered by: TRC. Available pack sizes: 100mg, 25mg, 50mg.
4-(3-methylsulfonylphenyl)-1-propyl-3,6-dihydro-2H-pyridine (CAS 346688-39-9) is a chemical compound with the molecular formula C15H21NO2S and a molecular weight of 279.4 g/mol. IUPAC name: 4-(3-methylsulfonylphenyl)-1-propyl-3,6-dihydro-2H-pyridine. InChIKey: YDZAGNOUGPIQDK-UHFFFAOYSA-N.
| Molecular formula | C15H21NO2S |
|---|---|
| Molecular weight | 279.4 g/mol |
| IUPAC name | 4-(3-methylsulfonylphenyl)-1-propyl-3,6-dihydro-2H-pyridine |
| InChIKey | YDZAGNOUGPIQDK-UHFFFAOYSA-N |
| SMILES | CCCN1CCC(=CC1)C2=CC(=CC=C2)S(=O)(=O)C |
Computed by PubChem (NCBI)