Products 346689-77-8
CAS 346689-77-8 appears in our catalog under these names: XR-11576, XR11576. Offered by: TargetMol, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, Get quote.
N-[(2R)-1-(dimethylamino)propan-2-yl]-4-methoxybenzo[a]phenazine-11-carboxamide (CAS 346689-77-8) is a chemical compound with the molecular formula C23H24N4O2 and a molecular weight of 388.5 g/mol. IUPAC name: N-[(2R)-1-(dimethylamino)propan-2-yl]-4-methoxybenzo[a]phenazine-11-carboxamide. InChIKey: ACAXGYADTLFREX-CQSZACIVSA-N.
| Molecular formula | C23H24N4O2 |
|---|---|
| Molecular weight | 388.5 g/mol |
| IUPAC name | N-[(2R)-1-(dimethylamino)propan-2-yl]-4-methoxybenzo[a]phenazine-11-carboxamide |
| InChIKey | ACAXGYADTLFREX-CQSZACIVSA-N |
| SMILES | C[C@H](CN(C)C)NC(=O)C1=C2C(=CC=C1)N=C3C=CC4=C(C3=N2)C=CC=C4OC |
Computed by PubChem (NCBI)