CAS 34669-52-8 is the registry number for (1S,2R,3S)-2,3-dimethylcyclopropane-1-carboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Cis-(2R,3S)-2,3-dimethylcyclopropane-1-carboxylic acid (CAS 34669-52-8) is a chemical compound with the molecular formula C6H10O2 and a molecular weight of 114.14 g/mol. IUPAC name: cis-(2R,3S)-2,3-dimethylcyclopropane-1-carboxylic acid. InChIKey: VEQMUQZKBLIXLT-NGQZWQHPSA-N.
| Molecular formula | C6H10O2 |
|---|---|
| Molecular weight | 114.14 g/mol |
| IUPAC name | cis-(2R,3S)-2,3-dimethylcyclopropane-1-carboxylic acid |
| InChIKey | VEQMUQZKBLIXLT-NGQZWQHPSA-N |
| SMILES | C[C@@H]1[C@@H](C1C(=O)O)C |
Computed by PubChem (NCBI)