Products 346690-97-9

CAS 346690-97-9 is the registry number for tert-Butyl N-(1-oxobutan-2-yl)carbamate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-(1-oxobutan-2-yl)carbamate (CAS 346690-97-9) is a chemical compound with the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. IUPAC name: tert-butyl N-(1-oxobutan-2-yl)carbamate. InChIKey: NBDAUFXJXMBQRC-UHFFFAOYSA-N.

Identity
Molecular formulaC9H17NO3
Molecular weight187.24 g/mol
IUPAC nametert-butyl N-(1-oxobutan-2-yl)carbamate
InChIKeyNBDAUFXJXMBQRC-UHFFFAOYSA-N
SMILESCCC(C=O)NC(=O)OC(C)(C)C

Computed by PubChem (NCBI)