CAS 346694-73-3 appears in our catalog under these names: 1–Benzyl–3–piperidone Hydrochloride Hydrate, 1-Benzylpiperidin-3-one hydrochloride hydrate 97%, 1-Benzyl-3-piperidone hydrochloride monohydrate, 95%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 100g.
1-benzylpiperidin-3-one;hydrochloride (CAS 346694-73-3) is a chemical compound with the molecular formula C12H16ClNO and a molecular weight of 225.71 g/mol. IUPAC name: 1-benzylpiperidin-3-one;hydrochloride. InChIKey: OVWSFXNSJDMRPV-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO |
|---|---|
| Molecular weight | 225.71 g/mol |
| IUPAC name | 1-benzylpiperidin-3-one;hydrochloride |
| InChIKey | OVWSFXNSJDMRPV-UHFFFAOYSA-N |
| SMILES | C1CC(=O)CN(C1)CC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)