CAS 34678-74-5 is the registry number for 1,3,5-Trimethyl-2-((4-methylphenyl)sulfanyl)benzene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
1,3,5-trimethyl-2-(4-methylphenyl)sulfanylbenzene (CAS 34678-74-5) is a chemical compound with the molecular formula C16H18S and a molecular weight of 242.4 g/mol. IUPAC name: 1,3,5-trimethyl-2-(4-methylphenyl)sulfanylbenzene. InChIKey: JHXLMRMLTBIVPY-UHFFFAOYSA-N.
| Molecular formula | C16H18S |
|---|---|
| Molecular weight | 242.4 g/mol |
| IUPAC name | 1,3,5-trimethyl-2-(4-methylphenyl)sulfanylbenzene |
| InChIKey | JHXLMRMLTBIVPY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)SC2=C(C=C(C=C2C)C)C |
Computed by PubChem (NCBI)