Products 34698-85-6

CAS 34698-85-6 is the registry number for 7-Hydroxy DAMPA, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg.

Structural formula: {0} (CAS {1})

4-[(2,4-diamino-7-oxo-8H-pteridin-6-yl)methyl-methylamino]benzoic acid (CAS 34698-85-6) is a chemical compound with the molecular formula C15H15N7O3 and a molecular weight of 341.32 g/mol. IUPAC name: 4-[(2,4-diamino-7-oxo-8H-pteridin-6-yl)methyl-methylamino]benzoic acid. InChIKey: VHQQBESFTXCNQV-UHFFFAOYSA-N.

Identity
Molecular formulaC15H15N7O3
Molecular weight341.32 g/mol
IUPAC name4-[(2,4-diamino-7-oxo-8H-pteridin-6-yl)methyl-methylamino]benzoic acid
InChIKeyVHQQBESFTXCNQV-UHFFFAOYSA-N
SMILESCN(CC1=NC2=C(N=C(N=C2NC1=O)N)N)C3=CC=C(C=C3)C(=O)O

Computed by PubChem (NCBI)