CAS 34698-85-6 is the registry number for 7-Hydroxy DAMPA, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg.
4-[(2,4-diamino-7-oxo-8H-pteridin-6-yl)methyl-methylamino]benzoic acid (CAS 34698-85-6) is a chemical compound with the molecular formula C15H15N7O3 and a molecular weight of 341.32 g/mol. IUPAC name: 4-[(2,4-diamino-7-oxo-8H-pteridin-6-yl)methyl-methylamino]benzoic acid. InChIKey: VHQQBESFTXCNQV-UHFFFAOYSA-N.
| Molecular formula | C15H15N7O3 |
|---|---|
| Molecular weight | 341.32 g/mol |
| IUPAC name | 4-[(2,4-diamino-7-oxo-8H-pteridin-6-yl)methyl-methylamino]benzoic acid |
| InChIKey | VHQQBESFTXCNQV-UHFFFAOYSA-N |
| SMILES | CN(CC1=NC2=C(N=C(N=C2NC1=O)N)N)C3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)