CAS 3470-36-8 is the registry number for 5-Keto-D-gluconic acid hemicalcium salt. Offered by: Biosynth. Available pack sizes: 1g, 0,5g, 2g, 10g, 5g.
Calcium bis((2R,3S,4S)-2,3,4,6-tetrahydroxy-5-oxohexanoate) (CAS 3470-36-8) is a chemical compound with the molecular formula C12H18CaO14 and a molecular weight of 426.34 g/mol. IUPAC name: calcium bis((2R,3S,4S)-2,3,4,6-tetrahydroxy-5-oxohexanoate). InChIKey: HNXKHQGRMMZMKP-UINDWOIOSA-L.
| Molecular formula | C12H18CaO14 |
|---|---|
| Molecular weight | 426.34 g/mol |
| IUPAC name | calcium bis((2R,3S,4S)-2,3,4,6-tetrahydroxy-5-oxohexanoate) |
| InChIKey | HNXKHQGRMMZMKP-UINDWOIOSA-L |
| SMILES | C(C(=O)[C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O.C(C(=O)[C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O.[Ca+2] |
Computed by PubChem (NCBI)