CAS 34701-98-9 is the registry number for [1,1'-Biphenyl]-4-yl(2-chlorophenyl)methanone, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2-chlorophenyl)-(4-phenylphenyl)methanone (CAS 34701-98-9) is a chemical compound with the molecular formula C19H13ClO and a molecular weight of 292.8 g/mol. IUPAC name: (2-chlorophenyl)-(4-phenylphenyl)methanone. InChIKey: ZSENJSDVZBWPKH-UHFFFAOYSA-N.
| Molecular formula | C19H13ClO |
|---|---|
| Molecular weight | 292.8 g/mol |
| IUPAC name | (2-chlorophenyl)-(4-phenylphenyl)methanone |
| InChIKey | ZSENJSDVZBWPKH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)C3=CC=CC=C3Cl |
Computed by PubChem (NCBI)