CAS 34702-00-6 is the registry number for (2-Chlorophenyl)(3,4-dimethoxyphenyl)methanone. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
(2-chlorophenyl)-(3,4-dimethoxyphenyl)methanone (CAS 34702-00-6) is a chemical compound with the molecular formula C15H13ClO3 and a molecular weight of 276.71 g/mol. IUPAC name: (2-chlorophenyl)-(3,4-dimethoxyphenyl)methanone. InChIKey: HZUYRIJHVQPPEK-UHFFFAOYSA-N.
| Molecular formula | C15H13ClO3 |
|---|---|
| Molecular weight | 276.71 g/mol |
| IUPAC name | (2-chlorophenyl)-(3,4-dimethoxyphenyl)methanone |
| InChIKey | HZUYRIJHVQPPEK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)C2=CC=CC=C2Cl)OC |
Computed by PubChem (NCBI)