CAS 34708-90-2 is the registry number for 3-(2-thienyl)indeno(3,2-c)pyrazol-4-one. Offered by: Biosynth. Available pack sizes: 250mg.
3-thiophen-2-yl-2H-indeno[1,2-c]pyrazol-4-one (CAS 34708-90-2) is a chemical compound with the molecular formula C14H8N2OS and a molecular weight of 252.29 g/mol. IUPAC name: 3-thiophen-2-yl-2H-indeno[1,2-c]pyrazol-4-one. InChIKey: DEDXYUREJUSWOW-UHFFFAOYSA-N.
| Molecular formula | C14H8N2OS |
|---|---|
| Molecular weight | 252.29 g/mol |
| IUPAC name | 3-thiophen-2-yl-2H-indeno[1,2-c]pyrazol-4-one |
| InChIKey | DEDXYUREJUSWOW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=NNC(=C3C2=O)C4=CC=CS4 |
Computed by PubChem (NCBI)