Products 34733-73-8
CAS 34733-73-8 is the registry number for (R)-(+)-Camphor-d2. Offered by: TRC. Available pack sizes: 0,5mg, 10mg, 5mg.
(1S,4R)-3,3-dideuterio-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one (CAS 34733-73-8) is a chemical compound with the molecular formula C10H16O and a molecular weight of 154.25 g/mol. IUPAC name: (1S,4R)-3,3-dideuterio-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one. InChIKey: DSSYKIVIOFKYAU-SVUHGRSUSA-N.
| Molecular formula | C10H16O |
|---|---|
| Molecular weight | 154.25 g/mol |
| IUPAC name | (1S,4R)-3,3-dideuterio-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| InChIKey | DSSYKIVIOFKYAU-SVUHGRSUSA-N |
| SMILES | [2H]C1([C@H]2CC[C@](C1=O)(C2(C)C)C)[2H] |
Computed by PubChem (NCBI)