Products 34749-22-9

CAS 34749-22-9 is the registry number for Moracizine Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl N-[10-(3-chloropropanoyl)phenothiazin-2-yl]carbamate (CAS 34749-22-9) is a chemical compound with the molecular formula C18H17ClN2O3S and a molecular weight of 376.9 g/mol. IUPAC name: ethyl N-[10-(3-chloropropanoyl)phenothiazin-2-yl]carbamate. InChIKey: HJLNLVIQJYXVBB-UHFFFAOYSA-N.

Identity
Molecular formulaC18H17ClN2O3S
Molecular weight376.9 g/mol
IUPAC nameethyl N-[10-(3-chloropropanoyl)phenothiazin-2-yl]carbamate
InChIKeyHJLNLVIQJYXVBB-UHFFFAOYSA-N
SMILESCCOC(=O)NC1=CC2=C(C=C1)SC3=CC=CC=C3N2C(=O)CCCl

Computed by PubChem (NCBI)