CAS 34769-44-3 appears in our catalog under these names: Usnicacidsodium, 98%, Usnic Acid Sodium, >95% (HPLC), Usnic Acid sodium/ 100%, 2,6-Diacetyl-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3(2H,9bH)-dione monosodium, Usnic acid (sodium). Offered by: Chemat Brand, TRC, TargetMol, Biosynth, MedChemExpress. Available pack sizes: on request, 10g, 1g, 10mg, 25mg, 50mg, 100mg, 25g.
Sodium 2,6-diacetyl-7,9-dihydroxy-8,9b-dimethyldibenzofuran-2-ide-1,3-dione (CAS 34769-44-3) is a chemical compound with the molecular formula C18H15NaO7 and a molecular weight of 366.3 g/mol. IUPAC name: sodium 2,6-diacetyl-7,9-dihydroxy-8,9b-dimethyldibenzofuran-2-ide-1,3-dione. InChIKey: XAIVUDQXALPCBH-UHFFFAOYSA-N.
| Molecular formula | C18H15NaO7 |
|---|---|
| Molecular weight | 366.3 g/mol |
| IUPAC name | sodium 2,6-diacetyl-7,9-dihydroxy-8,9b-dimethyldibenzofuran-2-ide-1,3-dione |
| InChIKey | XAIVUDQXALPCBH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C2C(=C1O)C3(C(=CC(=O)[C-](C3=O)C(=O)C)O2)C)C(=O)C)O.[Na+] |
Computed by PubChem (NCBI)