Products 347840-08-8
CAS 347840-08-8 appears in our catalog under these names: (±)-2-Methyl-d3-succinic-2,3,3-d3 Acid, >95% (HPLC), (±)-2-Methyl-d3-succinic-2,3,3-d3 Acid, 98 atom % D, min 98% Chemical Purity, 2-Methylsuccinic acid-d6, 99.9%. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 10mg, 50mg, 5mg, 0,5g, 0,25g, 50 mg, 100 mg, 25 mg.
2,2,3-trideuterio-3-(trideuteriomethyl)butanedioic acid (CAS 347840-08-8) is a chemical compound with the molecular formula C5H8O4 and a molecular weight of 138.15 g/mol. IUPAC name: 2,2,3-trideuterio-3-(trideuteriomethyl)butanedioic acid. InChIKey: WXUAQHNMJWJLTG-LIDOUZCJSA-N.
| Molecular formula | C5H8O4 |
|---|---|
| Molecular weight | 138.15 g/mol |
| IUPAC name | 2,2,3-trideuterio-3-(trideuteriomethyl)butanedioic acid |
| InChIKey | WXUAQHNMJWJLTG-LIDOUZCJSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C(=O)O)C([2H])([2H])C(=O)O |
Computed by PubChem (NCBI)