CAS 347841-48-9 appears in our catalog under these names: Malathion-d10, Malathion (Diethyl-d10), >95% (HPLC), Malathion D10 (diethyl D10), Malathion-d10 (diethyl-d10), 99 atom % D, min 95% Chemical Purity, Malathion–d10. Offered by: Hubei YoungXin, TRC, Dr. Ehrenstorfer, CDN, GLPBio. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 0,01g, 5mg.
Bis(1,1,2,2,2-pentadeuterioethyl) 2-dimethoxyphosphinothioylsulfanylbutanedioate (CAS 347841-48-9) is a chemical compound with the molecular formula C10H19O6PS2 and a molecular weight of 340.4 g/mol. IUPAC name: bis(1,1,2,2,2-pentadeuterioethyl) 2-dimethoxyphosphinothioylsulfanylbutanedioate. InChIKey: JXSJBGJIGXNWCI-JKSUIMTKSA-N.
| Molecular formula | C10H19O6PS2 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | bis(1,1,2,2,2-pentadeuterioethyl) 2-dimethoxyphosphinothioylsulfanylbutanedioate |
| InChIKey | JXSJBGJIGXNWCI-JKSUIMTKSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC(=O)CC(C(=O)OC([2H])([2H])C([2H])([2H])[2H])SP(=S)(OC)OC |
Computed by PubChem (NCBI)