Products 347841-83-2
CAS 347841-83-2 appears in our catalog under these names: 2,3,6-Trimethylphenol-d11, 98 atom % D, min 98% Chemical Purity, 2,3,6-Trimethylphenol-d11, 98.4%, D11-2,3,6-Trimethylphenol, D11-2,3,6-Trimethylphenol, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: CDN, MedChemExpress, HPC Standards. Available pack sizes: 0,5g, 0,25g, 100 mg, 50 mg, 10 mg, 25 mg, 1x10mg, 1x1ml.
3,4-dideuterio-2,5,6-tris(trideuteriomethyl)phenol (CAS 347841-83-2) is a chemical compound with the molecular formula C9H12O and a molecular weight of 147.26 g/mol. IUPAC name: 3,4-dideuterio-2,5,6-tris(trideuteriomethyl)phenol. InChIKey: QQOMQLYQAXGHSU-JXCHDVSKSA-N.
| Molecular formula | C9H12O |
|---|---|
| Molecular weight | 147.26 g/mol |
| IUPAC name | 3,4-dideuterio-2,5,6-tris(trideuteriomethyl)phenol |
| InChIKey | QQOMQLYQAXGHSU-JXCHDVSKSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])C([2H])([2H])[2H])O)C([2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)