CAS 347872-10-0 is the registry number for 2-(Perfluorobutylsulfonamido)propanoic Acid. Offered by: TRC. Available pack sizes: 250mg.
2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)propanoic acid (CAS 347872-10-0) is a chemical compound with the molecular formula C7H6F9NO4S and a molecular weight of 371.18 g/mol. IUPAC name: 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)propanoic acid. InChIKey: VDKPSKAXYKUKMK-UHFFFAOYSA-N.
| Molecular formula | C7H6F9NO4S |
|---|---|
| Molecular weight | 371.18 g/mol |
| IUPAC name | 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)propanoic acid |
| InChIKey | VDKPSKAXYKUKMK-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)NS(=O)(=O)C(C(C(C(F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)