CAS 34790-85-7 is the registry number for 1-(4-Chlorobenzyl)tetrahydropyrimidin-2(1H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(4-chlorophenyl)methyl]-1,3-diazinan-2-one (CAS 34790-85-7) is a chemical compound with the molecular formula C11H13ClN2O and a molecular weight of 224.68 g/mol. IUPAC name: 1-[(4-chlorophenyl)methyl]-1,3-diazinan-2-one. InChIKey: AAAJHRMBUHXWLD-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O |
|---|---|
| Molecular weight | 224.68 g/mol |
| IUPAC name | 1-[(4-chlorophenyl)methyl]-1,3-diazinan-2-one |
| InChIKey | AAAJHRMBUHXWLD-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)N(C1)CC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)