CAS 348-84-5 appears in our catalog under these names: 1-(4-Chloro-3-(trifluoromethyl)phenyl)ethanol, 97%, 1–(4–Chloro–3–(trifluoromethyl)phenyl)ethanol. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 250mg, 50mg.
1-[4-chloro-3-(trifluoromethyl)phenyl]ethanol (CAS 348-84-5) is a chemical compound with the molecular formula C9H8ClF3O and a molecular weight of 224.61 g/mol. IUPAC name: 1-[4-chloro-3-(trifluoromethyl)phenyl]ethanol. InChIKey: RMFUMJOARZCIFY-UHFFFAOYSA-N.
| Molecular formula | C9H8ClF3O |
|---|---|
| Molecular weight | 224.61 g/mol |
| IUPAC name | 1-[4-chloro-3-(trifluoromethyl)phenyl]ethanol |
| InChIKey | RMFUMJOARZCIFY-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1)Cl)C(F)(F)F)O |
Computed by PubChem (NCBI)