CAS 34844-48-9 appears in our catalog under these names: 1,1,1–Trifluoro–2–Trifluoromethylpentane–2,4–Diol, 1,1,1-trifluoro-2-trifluoromethyl-2,4-pentanediol, 98%, 98%, 1,1,1-Trifluoro-2-(trifluoromethyl)pentane-2,4-diol, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g.
1,1,1-trifluoro-2-(trifluoromethyl)pentane-2,4-diol (CAS 34844-48-9) is a chemical compound with the molecular formula C6H8F6O2 and a molecular weight of 226.12 g/mol. IUPAC name: 1,1,1-trifluoro-2-(trifluoromethyl)pentane-2,4-diol. InChIKey: QAJCOMPEAMJMEB-UHFFFAOYSA-N.
| Molecular formula | C6H8F6O2 |
|---|---|
| Molecular weight | 226.12 g/mol |
| IUPAC name | 1,1,1-trifluoro-2-(trifluoromethyl)pentane-2,4-diol |
| InChIKey | QAJCOMPEAMJMEB-UHFFFAOYSA-N |
| SMILES | CC(CC(C(F)(F)F)(C(F)(F)F)O)O |
Computed by PubChem (NCBI)