CAS 3486-76-8 appears in our catalog under these names: Gly-his hydrochloride hydrate, 95%, H-Gly-His-OH.HCl, 97%, H–Gly–His–OH · HCl, H-Gly-His-OH·HCl, GLY-HIS HYDROCHLORIDE HYDRATE, >=99.0%. Offered by: Combi-blocks, Chemat Brand, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 1g, on request, 25g, 5g, 2000mg, 5000mg, 10000mg.
(2S)-2-[(2-aminoacetyl)amino]-3-(1H-imidazol-5-yl)propanoic acid;hydrochloride (CAS 3486-76-8) is a chemical compound with the molecular formula C8H13ClN4O3 and a molecular weight of 248.67 g/mol. IUPAC name: (2S)-2-[(2-aminoacetyl)amino]-3-(1H-imidazol-5-yl)propanoic acid;hydrochloride. InChIKey: BAKFHUFFZULTOT-RGMNGODLSA-N.
| Molecular formula | C8H13ClN4O3 |
|---|---|
| Molecular weight | 248.67 g/mol |
| IUPAC name | (2S)-2-[(2-aminoacetyl)amino]-3-(1H-imidazol-5-yl)propanoic acid;hydrochloride |
| InChIKey | BAKFHUFFZULTOT-RGMNGODLSA-N |
| SMILES | C1=C(NC=N1)C[C@@H](C(=O)O)NC(=O)CN.Cl |
Computed by PubChem (NCBI)