CAS 34866-46-1 appears in our catalog under these names: Carbuterol HCl, Carbuterol (hydrochloride). Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
[5-[2-(tert-butylamino)-1-hydroxyethyl]-2-hydroxyphenyl]urea;hydrochloride (CAS 34866-46-1) is a chemical compound with the molecular formula C13H22ClN3O3 and a molecular weight of 303.78 g/mol. IUPAC name: [5-[2-(tert-butylamino)-1-hydroxyethyl]-2-hydroxyphenyl]urea;hydrochloride. InChIKey: QHWYYBXPBFQGNI-UHFFFAOYSA-N.
| Molecular formula | C13H22ClN3O3 |
|---|---|
| Molecular weight | 303.78 g/mol |
| IUPAC name | [5-[2-(tert-butylamino)-1-hydroxyethyl]-2-hydroxyphenyl]urea;hydrochloride |
| InChIKey | QHWYYBXPBFQGNI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC(C1=CC(=C(C=C1)O)NC(=O)N)O.Cl |
Computed by PubChem (NCBI)